C13H14IN7O2 — CID 155543135
(1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(azidomethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155543135) has the molecular formula C13H14IN7O2 and a molecular weight of 427.21 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(azidomethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(azidomethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155543135 |
| Molecular Formula | C13H14IN7O2 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(azidomethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | [N-]=[N+]=NC[C@@H]1[C@@H](O)[C@@H](O)[C@@]2(n3cc(I)c4c(N)ncnc43)C[C@@H]12 |
| InChI | InChI=1S/C13H14IN7O2/c14-7-3-21(12-8(7)11(15)17-4-18-12)13-1-6(13)5(2-19-20-16)9(22)10(13)23/h3-6,9-10,22-23H,1-2H2,(H2,15,17,18)/t5-,6-,9+,10+,13+/m0/s1 |
| InChIKey | KQMITLMWPOBFHU-KTCMLSIRSA-N |
| XLogP | 1.00 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|