C29H38N6O — CID 155543150
3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-heptylphenyl)propanamide (PubChem CID 155543150) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-heptylphenyl)propanamide.
| Compound Name | 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-heptylphenyl)propanamide |
|---|---|
| PubChem CID | 155543150 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-heptylphenyl)propanamide |
| SMILES | CCCCCCCc1ccc(NC(=O)CCn2cc(C[C@@]34CNC[C@@H]3Nc3ccccc34)nn2)cc1 |
| InChI | InChI=1S/C29H38N6O/c1-2-3-4-5-6-9-22-12-14-23(15-13-22)31-28(36)16-17-35-20-24(33-34-35)18-29-21-30-19-27(29)32-26-11-8-7-10-25(26)29/h7-8,10-15,20,27,30,32H,2-6,9,16-19,21H2,1H3,(H,31,36)/t27-,29-/m0/s1 |
| InChIKey | QNPOOIDNGZDFBD-YTMVLYRLSA-N |
| XLogP | 4.70 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|