About [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate
[4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate (PubChem CID 155543274) has the molecular formula C25H24ClF3N2O3
and a molecular weight of 492.93 g/mol. Its IUPAC name is [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate.
Molecular Properties
| Compound Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate |
| PubChem CID | 155543274 |
| Molecular Formula | C25H24ClF3N2O3 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)Oc1ccc(Cl)cc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24ClF3N2O3/c26-18-3-6-21(20(10-18)22(32)30-19-4-1-17(2-5-19)25(27,28)29)34-23(33)31-24-11-14-7-15(12-24)9-16(8-14)13-24/h1-6,10,14-16H,7-9,11-13H2,(H,30,32)(H,31,33) |
| InChIKey | HNPGIORXVRIICH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The IUPAC name of [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate (CID 155543274) is [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate.
What is the SMILES notation for [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The canonical SMILES for [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate is O=C(NC12CC3CC(CC(C3)C1)C2)Oc1ccc(Cl)cc1C(=O)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate?
The InChIKey is HNPGIORXVRIICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClF3N2O3/c26-18-3-6-21(20(10-18)22(32)30-19-4-1-17(2-5-19)25(27,28)29)34-23(33)31-24-11-14-7-15(12-24)9-16(8-14)13-24/h1-6,10,14-16H,7-9,11-13H2,(H,30,32)(H,31,33).
What are the key properties of [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate?
[4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate has a molecular weight of 492.93 g/mol, XLogP of 6.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-2-[[4-(trifluoromethyl)phenyl]carbamoyl]phenyl] N-(1-adamantyl)carbamate is sourced from PubChem (CID 155543274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).