C20H21N3O2 — CID 155543416
N-(2,2-diphenylethyl)-2,3-dimethyl-5-oxo-1H-pyrazole-4-carboxamide (PubChem CID 155543416) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-2,3-dimethyl-5-oxo-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-2,3-dimethyl-5-oxo-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155543416 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2,2-diphenylethyl)-2,3-dimethyl-5-oxo-1H-pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCC(c2ccccc2)c2ccccc2)c(=O)[nH]n1C |
| InChI | InChI=1S/C20H21N3O2/c1-14-18(20(25)22-23(14)2)19(24)21-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | XNUZSJRRIGQEKJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |