C28H28F2N4O2 — CID 155543444
3-[5-[4-(difluoromethoxy)phenyl]-3-ethyl-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 155543444) has the molecular formula C28H28F2N4O2 and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-[5-[4-(difluoromethoxy)phenyl]-3-ethyl-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[5-[4-(difluoromethoxy)phenyl]-3-ethyl-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 155543444 |
| Molecular Formula | C28H28F2N4O2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 3-[5-[4-(difluoromethoxy)phenyl]-3-ethyl-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | CCc1nc(-c2ccc(OC(F)F)cc2)n(-c2cccc(C(=O)NCCCCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C28H28F2N4O2/c1-2-25-32-26(21-14-16-24(17-15-21)36-28(29)30)34(33-25)23-13-8-12-22(19-23)27(35)31-18-7-6-11-20-9-4-3-5-10-20/h3-5,8-10,12-17,19,28H,2,6-7,11,18H2,1H3,(H,31,35) |
| InChIKey | PVUPRBZZFWOKOH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|