About 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone
1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone (PubChem CID 155543445) has the molecular formula C27H17F6NO
and a molecular weight of 485.43 g/mol. Its IUPAC name is 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone |
| PubChem CID | 155543445 |
| Molecular Formula | C27H17F6NO |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone |
| SMILES | CC(=O)c1c(/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C27H17F6NO/c1-16(35)24-23(12-11-17-13-19(26(28,29)30)15-20(14-17)27(31,32)33)34-22-10-6-5-9-21(22)25(24)18-7-3-2-4-8-18/h2-15H,1H3/b12-11+ |
| InChIKey | VAMPZAHHKZZTCI-VAWYXSNFSA-N |
| XLogP | 8.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone?
The IUPAC name of 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone (CID 155543445) is 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone.
What is the SMILES notation for 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone?
The canonical SMILES for 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone is CC(=O)c1c(/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc2ccccc2c1-c1ccccc1.
What is the InChIKey of 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone?
The InChIKey is VAMPZAHHKZZTCI-VAWYXSNFSA-N. The full InChI is InChI=1S/C27H17F6NO/c1-16(35)24-23(12-11-17-13-19(26(28,29)30)15-20(14-17)27(31,32)33)34-22-10-6-5-9-21(22)25(24)18-7-3-2-4-8-18/h2-15H,1H3/b12-11+.
What are the key properties of 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone?
1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone has a molecular weight of 485.43 g/mol, XLogP of 8.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-4-phenylquinolin-3-yl]ethanone is sourced from PubChem (CID 155543445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).