C30H26N10O4 — CID 155543588
1-N-[[2-[(1S)-1-[(2,6-diamino-5-cyanopyrimidin-4-yl)amino]ethyl]-4-oxo-3-phenylquinazolin-5-yl]methyl]-4-N-hydroxybenzene-1,4-dicarboxamide (PubChem CID 155543588) has the molecular formula C30H26N10O4 and a molecular weight of 590.60 g/mol. Its IUPAC name is 1-N-[[2-[(1S)-1-[(2,6-diamino-5-cyanopyrimidin-4-yl)amino]ethyl]-4-oxo-3-phenylquinazolin-5-yl]methyl]-4-N-hydroxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N-[[2-[(1S)-1-[(2,6-diamino-5-cyanopyrimidin-4-yl)amino]ethyl]-4-oxo-3-phenylquinazolin-5-yl]methyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 155543588 |
| Molecular Formula | C30H26N10O4 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 1-N-[[2-[(1S)-1-[(2,6-diamino-5-cyanopyrimidin-4-yl)amino]ethyl]-4-oxo-3-phenylquinazolin-5-yl]methyl]-4-N-hydroxybenzene-1,4-dicarboxamide |
| SMILES | C[C@H](Nc1nc(N)nc(N)c1C#N)c1nc2cccc(CNC(=O)c3ccc(C(=O)NO)cc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H26N10O4/c1-16(35-25-21(14-31)24(32)37-30(33)38-25)26-36-22-9-5-6-19(23(22)29(43)40(26)20-7-3-2-4-8-20)15-34-27(41)17-10-12-18(13-11-17)28(42)39-44/h2-13,16,44H,15H2,1H3,(H,34,41)(H,39,42)(H5,32,33,35,37,38)/t16-/m0/s1 |
| InChIKey | UDIGTKMLGJNRSL-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 226.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|