C29H29N3O10S — CID 155543695
(2S,3S,4S,5R,6S)-6-[4-(2-carboxyethyl)-1-[[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]pyrazol-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 155543695) has the molecular formula C29H29N3O10S and a molecular weight of 611.63 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-(2-carboxyethyl)-1-[[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]pyrazol-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-(2-carboxyethyl)-1-[[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]pyrazol-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 155543695 |
| Molecular Formula | C29H29N3O10S |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-(2-carboxyethyl)-1-[[4-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenyl]methyl]pyrazol-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)CCc1cn(Cc2ccc(OCc3csc(-c4ccccc4)n3)cc2)nc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H29N3O10S/c33-21(34)11-8-18-13-32(31-26(18)42-29-24(37)22(35)23(36)25(41-29)28(38)39)12-16-6-9-20(10-7-16)40-14-19-15-43-27(30-19)17-4-2-1-3-5-17/h1-7,9-10,13,15,22-25,29,35-37H,8,11-12,14H2,(H,33,34)(H,38,39)/t22-,23-,24+,25-,29-/m0/s1 |
| InChIKey | RILBUEPDLIIYRF-GMQKQUAPSA-N |
| XLogP | 1.92 |
| TPSA | 193.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |