C24H30ClN7O5S — CID 155543712
N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-[hydroxymethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 155543712) has the molecular formula C24H30ClN7O5S and a molecular weight of 564.07 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-[hydroxymethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-[hydroxymethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 155543712 |
| Molecular Formula | C24H30ClN7O5S |
| Molecular Weight | 564.07 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-[hydroxymethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)CO)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1 |
| InChI | InChI=1S/C24H30ClN7O5S/c1-31-8-7-16-18(11-31)38-23(29-16)22(36)28-17-9-13(24(37)32(2)12-33)3-5-15(17)27-20(34)21(35)30-19-6-4-14(25)10-26-19/h4,6,10,13,15,17,33H,3,5,7-9,11-12H2,1-2H3,(H,27,34)(H,28,36)(H,26,30,35)/t13-,15-,17+/m0/s1 |
| InChIKey | PLNLONVCUKZPEM-JLJPHGGASA-N |
| XLogP | 0.61 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.07 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|