C21H26N4O2S2 — CID 155543724
N-[(5R)-3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155543724) has the molecular formula C21H26N4O2S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-[(5R)-3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[(5R)-3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155543724 |
| Molecular Formula | C21H26N4O2S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[(5R)-3-(1,3-benzothiazol-2-yl)-5-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)C[C@@H](C)NC2 |
| InChI | InChI=1S/C21H26N4O2S2/c1-13-11-14-17(12-23-13)29-21(25-18(26)7-8-22-9-10-27-2)19(14)20-24-15-5-3-4-6-16(15)28-20/h3-6,13,22-23H,7-12H2,1-2H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | BVFSJWKEHRQLOY-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|