C32H33N3O4S — CID 155543775
(E)-N-[6-[3-[(4-phenoxyphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 155543775) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is (E)-N-[6-[3-[(4-phenoxyphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[6-[3-[(4-phenoxyphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 155543775 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | (E)-N-[6-[3-[(4-phenoxyphenyl)sulfamoyl]phenyl]hexyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCCCCCc1cccc(S(=O)(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H33N3O4S/c36-32(21-16-27-12-9-22-33-25-27)34-23-7-2-1-4-10-26-11-8-15-31(24-26)40(37,38)35-28-17-19-30(20-18-28)39-29-13-5-3-6-14-29/h3,5-6,8-9,11-22,24-25,35H,1-2,4,7,10,23H2,(H,34,36)/b21-16+ |
| InChIKey | DCLCUUUBOFUPIF-LTGZKZEYSA-N |
| XLogP | 6.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|