C13H9F3N6 — CID 155543847
6-N-(3,4,5-trifluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine (PubChem CID 155543847) has the molecular formula C13H9F3N6 and a molecular weight of 306.25 g/mol. Its IUPAC name is 6-N-(3,4,5-trifluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(3,4,5-trifluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 155543847 |
| Molecular Formula | C13H9F3N6 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 6-N-(3,4,5-trifluorophenyl)pyrido[3,2-d]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c2nc(Nc3cc(F)c(F)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C13H9F3N6/c14-6-3-5(4-7(15)10(6)16)19-9-2-1-8-11(21-9)12(17)22-13(18)20-8/h1-4H,(H,19,21)(H4,17,18,20,22) |
| InChIKey | JRPWTASLGZCEKZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|