C35H39N9O2 — CID 155543933
2-[(1S)-1-[[5-[3-[[4-(dimethylamino)piperidin-1-yl]methyl]-4-hydroxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 155543933) has the molecular formula C35H39N9O2 and a molecular weight of 617.76 g/mol. Its IUPAC name is 2-[(1S)-1-[[5-[3-[[4-(dimethylamino)piperidin-1-yl]methyl]-4-hydroxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(1S)-1-[[5-[3-[[4-(dimethylamino)piperidin-1-yl]methyl]-4-hydroxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 155543933 |
| Molecular Formula | C35H39N9O2 |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 2-[(1S)-1-[[5-[3-[[4-(dimethylamino)piperidin-1-yl]methyl]-4-hydroxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]-5-methyl-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1ccn2nc([C@H](C)Nc3ncnc4[nH]cc(-c5ccc(O)c(CN6CCC(N(C)C)CC6)c5)c34)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C35H39N9O2/c1-22-12-17-43-31(22)35(46)44(27-8-6-5-7-9-27)34(40-43)23(2)39-33-30-28(19-36-32(30)37-21-38-33)24-10-11-29(45)25(18-24)20-42-15-13-26(14-16-42)41(3)4/h5-12,17-19,21,23,26,45H,13-16,20H2,1-4H3,(H2,36,37,38,39)/t23-/m0/s1 |
| InChIKey | RTJKOLIMBPYBJS-QHCPKHFHSA-N |
| XLogP | 5.14 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|