C13H10BrF3N4S3 — CID 155543993
1-[4-bromo-2-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)thiourea (PubChem CID 155543993) has the molecular formula C13H10BrF3N4S3 and a molecular weight of 455.35 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)thiourea.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)thiourea |
|---|---|
| PubChem CID | 155543993 |
| Molecular Formula | C13H10BrF3N4S3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-3-(5-prop-2-enylsulfanyl-1,2,4-thiadiazol-3-yl)thiourea |
| SMILES | C=CCSc1nc(NC(=S)Nc2ccc(Br)cc2C(F)(F)F)ns1 |
| InChI | InChI=1S/C13H10BrF3N4S3/c1-2-5-23-12-20-10(21-24-12)19-11(22)18-9-4-3-7(14)6-8(9)13(15,16)17/h2-4,6H,1,5H2,(H2,18,19,21,22) |
| InChIKey | ZTNLZOFHGZNBEB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|