C31H36BF4N3 — CID 155543998
8,14,22-tributyl-14,22-diaza-8-azoniahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaene tetrafluoroborate (PubChem CID 155543998) has the molecular formula C31H36BF4N3 and a molecular weight of 537.45 g/mol. Its IUPAC name is 8,14,22-tributyl-14,22-diaza-8-azoniahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaene tetrafluoroborate.
| Compound Name | 8,14,22-tributyl-14,22-diaza-8-azoniahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaene tetrafluoroborate |
|---|---|
| PubChem CID | 155543998 |
| Molecular Formula | C31H36BF4N3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 8,14,22-tributyl-14,22-diaza-8-azoniahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaene tetrafluoroborate |
| SMILES | CCCCn1c2cccc3c2-c2c4c1cccc4[n+](CCCC)c1cccc(c21)n3CCCC.F[B-](F)(F)F |
| InChI | InChI=1S/C31H36N3.BF4/c1-4-7-19-32-22-13-10-15-24-28(22)31-29-23(32)14-11-16-25(29)34(21-9-6-3)27-18-12-17-26(30(27)31)33(24)20-8-5-2;2-1(3,4)5/h10-18H,4-9,19-21H2,1-3H3;/q+1;-1 |
| InChIKey | OSUOOLXJRCLMCY-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|