C24H28Cl2N4O4S2 — CID 155544130
(2E)-3-(3-chlorophenyl)-N-[2-[2-[[(2E)-3-(3-chlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide (PubChem CID 155544130) has the molecular formula C24H28Cl2N4O4S2 and a molecular weight of 571.55 g/mol. Its IUPAC name is (2E)-3-(3-chlorophenyl)-N-[2-[2-[[(2E)-3-(3-chlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide.
| Compound Name | (2E)-3-(3-chlorophenyl)-N-[2-[2-[[(2E)-3-(3-chlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide |
|---|---|
| PubChem CID | 155544130 |
| Molecular Formula | C24H28Cl2N4O4S2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | (2E)-3-(3-chlorophenyl)-N-[2-[2-[[(2E)-3-(3-chlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide |
| SMILES | CO/N=C(\Cc1cccc(Cl)c1)C(=O)NCCSSCCNC(=O)/C(Cc1cccc(Cl)c1)=N/OC |
| InChI | InChI=1S/C24H28Cl2N4O4S2/c1-33-29-21(15-17-5-3-7-19(25)13-17)23(31)27-9-11-35-36-12-10-28-24(32)22(30-34-2)16-18-6-4-8-20(26)14-18/h3-8,13-14H,9-12,15-16H2,1-2H3,(H,27,31)(H,28,32)/b29-21+,30-22+ |
| InChIKey | AJGCTJSDUIEBQD-VFIVCBTMSA-N |
| XLogP | 4.40 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|