About 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole
1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole (PubChem CID 155544140) has the molecular formula C24H17Cl2N3
and a molecular weight of 418.33 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole |
| PubChem CID | 155544140 |
| Molecular Formula | C24H17Cl2N3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole |
| SMILES | Clc1ccc(C(c2c[nH]cc2-c2ccc3ccccc3c2)n2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl2N3/c25-19-7-8-20(23(26)12-19)24(29-10-9-27-15-29)22-14-28-13-21(22)18-6-5-16-3-1-2-4-17(16)11-18/h1-15,24,28H |
| InChIKey | ZABWFZXICLSWBV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole?
The IUPAC name of 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole (CID 155544140) is 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole?
The canonical SMILES for 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole is Clc1ccc(C(c2c[nH]cc2-c2ccc3ccccc3c2)n2ccnc2)c(Cl)c1.
What is the InChIKey of 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole?
The InChIKey is ZABWFZXICLSWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17Cl2N3/c25-19-7-8-20(23(26)12-19)24(29-10-9-27-15-29)22-14-28-13-21(22)18-6-5-16-3-1-2-4-17(16)11-18/h1-15,24,28H.
What are the key properties of 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole?
1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole has a molecular weight of 418.33 g/mol, XLogP of 6.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)-(4-naphthalen-2-yl-1H-pyrrol-3-yl)methyl]imidazole is sourced from PubChem (CID 155544140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).