C30H44N4O2 — CID 155544161
(1R,2R,9S,17S)-11-[(1R,2R,9S,14S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-14-yl]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-10-en-6-one (PubChem CID 155544161) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is (1R,2R,9S,17S)-11-[(1R,2R,9S,14S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-14-yl]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-10-en-6-one.
| Compound Name | (1R,2R,9S,17S)-11-[(1R,2R,9S,14S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-14-yl]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-10-en-6-one |
|---|---|
| PubChem CID | 155544161 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (1R,2R,9S,17S)-11-[(1R,2R,9S,14S,17S)-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-14-yl]-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-10-en-6-one |
| SMILES | O=C1CCC[C@@H]2[C@H]3CCCN4CC([C@@H]5CC[C@H]6[C@@H]7[C@@H](CCCN75)CN5C(=O)CCC[C@H]65)=C[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C30H44N4O2/c35-27-9-2-8-26-23-11-12-24(32-14-3-5-19(30(23)32)17-33(26)27)20-15-21-18-34-25(7-1-10-28(34)36)22-6-4-13-31(16-20)29(21)22/h15,19,21-26,29-30H,1-14,16-18H2/t19-,21-,22+,23+,24-,25+,26+,29-,30-/m0/s1 |
| InChIKey | SVARGOXDJHAGJN-ARYDGDJYSA-N |
| XLogP | 3.27 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|