About 2-(4-nitrophenoxy)ethyl selenocyanate
2-(4-nitrophenoxy)ethyl selenocyanate (PubChem CID 155544236) has the molecular formula C9H8N2O3Se
and a molecular weight of 271.13 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)ethyl selenocyanate.
Molecular Properties
| Compound Name | 2-(4-nitrophenoxy)ethyl selenocyanate |
| PubChem CID | 155544236 |
| Molecular Formula | C9H8N2O3Se |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2-(4-nitrophenoxy)ethyl selenocyanate |
| SMILES | N#C[Se]CCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H8N2O3Se/c10-7-15-6-5-14-9-3-1-8(2-4-9)11(12)13/h1-4H,5-6H2 |
| InChIKey | IPDXAGOYCWCTQJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenoxy)ethyl selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenoxy)ethyl selenocyanate?
The IUPAC name of 2-(4-nitrophenoxy)ethyl selenocyanate (CID 155544236) is 2-(4-nitrophenoxy)ethyl selenocyanate.
What is the SMILES notation for 2-(4-nitrophenoxy)ethyl selenocyanate?
The canonical SMILES for 2-(4-nitrophenoxy)ethyl selenocyanate is N#C[Se]CCOc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-(4-nitrophenoxy)ethyl selenocyanate?
The InChIKey is IPDXAGOYCWCTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3Se/c10-7-15-6-5-14-9-3-1-8(2-4-9)11(12)13/h1-4H,5-6H2.
What are the key properties of 2-(4-nitrophenoxy)ethyl selenocyanate?
2-(4-nitrophenoxy)ethyl selenocyanate has a molecular weight of 271.13 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenoxy)ethyl selenocyanate is sourced from PubChem (CID 155544236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).