C31H46N4O5 — CID 155544252
(3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(7-methyl-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 155544252) has the molecular formula C31H46N4O5 and a molecular weight of 554.73 g/mol. Its IUPAC name is (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(7-methyl-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(7-methyl-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 155544252 |
| Molecular Formula | C31H46N4O5 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(7-methyl-6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)C(C)C)NC(=O)[C@H]2C[C@H](C)CN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C31H46N4O5/c1-6-31(5)30(40)33-24(18-22-13-9-7-10-14-22)29(39)35-19-21(4)17-25(35)28(38)32-23(27(37)34-31)15-11-8-12-16-26(36)20(2)3/h7,9-10,13-14,20-21,23-25H,6,8,11-12,15-19H2,1-5H3,(H,32,38)(H,33,40)(H,34,37)/t21-,23-,24-,25+,31-/m0/s1 |
| InChIKey | UKEZHPPHQQLUFK-DXOXNYLRSA-N |
| XLogP | 2.91 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|