C27H30N2O6 — CID 155544455
(4R,5S)-2,4,5-tris(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 155544455) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is (4R,5S)-2,4,5-tris(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-tris(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 155544455 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (4R,5S)-2,4,5-tris(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(OC)c(OC)c3)[C@H](c3ccc(OC)c(OC)c3)N2)cc1OC |
| InChI | InChI=1S/C27H30N2O6/c1-30-19-10-7-16(13-22(19)33-4)25-26(17-8-11-20(31-2)23(14-17)34-5)29-27(28-25)18-9-12-21(32-3)24(15-18)35-6/h7-15,25-26H,1-6H3,(H,28,29)/t25-,26+ |
| InChIKey | YVCCFPDGZHXPNB-WMPKNSHKSA-N |
| XLogP | 4.57 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |