About 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea
1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea (PubChem CID 155544468) has the molecular formula C20H18F2N4O4
and a molecular weight of 416.38 g/mol. Its IUPAC name is 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea |
| PubChem CID | 155544468 |
| Molecular Formula | C20H18F2N4O4 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(Oc2c(F)cccc2F)c(-c2ccc(OCCO)nc2)cn1 |
| InChI | InChI=1S/C20H18F2N4O4/c1-23-20(28)26-17-9-16(30-19-14(21)3-2-4-15(19)22)13(11-24-17)12-5-6-18(25-10-12)29-8-7-27/h2-6,9-11,27H,7-8H2,1H3,(H2,23,24,26,28) |
| InChIKey | MLBLDXFEOCEMSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea?
The IUPAC name of 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea (CID 155544468) is 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea.
What is the SMILES notation for 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea?
The canonical SMILES for 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea is CNC(=O)Nc1cc(Oc2c(F)cccc2F)c(-c2ccc(OCCO)nc2)cn1.
What is the InChIKey of 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea?
The InChIKey is MLBLDXFEOCEMSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N4O4/c1-23-20(28)26-17-9-16(30-19-14(21)3-2-4-15(19)22)13(11-24-17)12-5-6-18(25-10-12)29-8-7-27/h2-6,9-11,27H,7-8H2,1H3,(H2,23,24,26,28).
What are the key properties of 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea?
1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea has a molecular weight of 416.38 g/mol, XLogP of 3.34, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,6-difluorophenoxy)-5-[6-(2-hydroxyethoxy)-3-pyridinyl]-2-pyridinyl]-3-methylurea is sourced from PubChem (CID 155544468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).