C39H38BrN3O — CID 155544493
(6aR,11bR)-4-methoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide (PubChem CID 155544493) has the molecular formula C39H38BrN3O and a molecular weight of 644.66 g/mol. Its IUPAC name is (6aR,11bR)-4-methoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide.
| Compound Name | (6aR,11bR)-4-methoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
|---|---|
| PubChem CID | 155544493 |
| Molecular Formula | C39H38BrN3O |
| Molecular Weight | 644.66 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | (6aR,11bR)-4-methoxy-5-[3-[2-methyl-3-(naphthalen-2-ylmethyl)benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
| SMILES | COc1cccc2c1N(CCCn1c(C)[n+](Cc3ccc4ccccc4c3)c3ccccc31)C[C@@H]1Cc3ccccc3[C@H]21.[Br-] |
| InChI | InChI=1S/C39H38N3O.BrH/c1-27-41(35-16-7-8-17-36(35)42(27)25-28-19-20-29-11-3-4-12-30(29)23-28)22-10-21-40-26-32-24-31-13-5-6-14-33(31)38(32)34-15-9-18-37(43-2)39(34)40;/h3-9,11-20,23,32,38H,10,21-22,24-26H2,1-2H3;1H/q+1;/p-1/t32-,38+;/m0./s1 |
| InChIKey | AQFBTQAANDJCOF-HHOTWYOOSA-M |
| XLogP | 4.67 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|