C23H32O5 — CID 155544562
methyl (4aR,10aS)-9-ethoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate (PubChem CID 155544562) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl (4aR,10aS)-9-ethoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate.
| Compound Name | methyl (4aR,10aS)-9-ethoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate |
|---|---|
| PubChem CID | 155544562 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl (4aR,10aS)-9-ethoxy-1,1-dimethyl-5,6-dioxo-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate |
| SMILES | CCOC1C[C@H]2C(C)(C)CCC[C@]2(C(=O)OC)C2=C1C=C(C(C)C)C(=O)C2=O |
| InChI | InChI=1S/C23H32O5/c1-7-28-16-12-17-22(4,5)9-8-10-23(17,21(26)27-6)18-15(16)11-14(13(2)3)19(24)20(18)25/h11,13,16-17H,7-10,12H2,1-6H3/t16?,17-,23+/m0/s1 |
| InChIKey | UPMSARCKQPBCBJ-KMXYETGPSA-N |
| XLogP | 3.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|