About 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole
3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole (PubChem CID 155544886) has the molecular formula C25H17FN6
and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole |
| PubChem CID | 155544886 |
| Molecular Formula | C25H17FN6 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole |
| SMILES | Fc1ccc(-c2nc(-c3nnnn3Cc3ccccc3)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C25H17FN6/c26-18-12-10-17(11-13-18)23-24-20(19-8-4-5-9-21(19)27-24)14-22(28-23)25-29-30-31-32(25)15-16-6-2-1-3-7-16/h1-14,27H,15H2 |
| InChIKey | MMAKLTRZWCGJMX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole (CID 155544886) is 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole is Fc1ccc(-c2nc(-c3nnnn3Cc3ccccc3)cc3c2[nH]c2ccccc23)cc1.
What is the InChIKey of 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The InChIKey is MMAKLTRZWCGJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17FN6/c26-18-12-10-17(11-13-18)23-24-20(19-8-4-5-9-21(19)27-24)14-22(28-23)25-29-30-31-32(25)15-16-6-2-1-3-7-16/h1-14,27H,15H2.
What are the key properties of 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole has a molecular weight of 420.45 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzyltetrazol-5-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 155544886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).