C22H17F3N4O — CID 155544904
2-methoxy-5-[4-[[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]methyl]phenyl]pyridine (PubChem CID 155544904) has the molecular formula C22H17F3N4O and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-methoxy-5-[4-[[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]methyl]phenyl]pyridine.
| Compound Name | 2-methoxy-5-[4-[[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]methyl]phenyl]pyridine |
|---|---|
| PubChem CID | 155544904 |
| Molecular Formula | C22H17F3N4O |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-methoxy-5-[4-[[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]methyl]phenyl]pyridine |
| SMILES | COc1ccc(-c2ccc(Cn3cc(-c4ccc(C(F)(F)F)cc4)nn3)cc2)cn1 |
| InChI | InChI=1S/C22H17F3N4O/c1-30-21-11-8-18(12-26-21)16-4-2-15(3-5-16)13-29-14-20(27-28-29)17-6-9-19(10-7-17)22(23,24)25/h2-12,14H,13H2,1H3 |
| InChIKey | XMICLSPUPFMDHT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |