C25H27N3O3 — CID 155544958
(17S,23S)-14-ethenyl-7,7,14-trimethyl-8-oxa-12,15,21-triazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2(11),3,5,9-pentaene-16,22-dione (PubChem CID 155544958) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is (17S,23S)-14-ethenyl-7,7,14-trimethyl-8-oxa-12,15,21-triazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2(11),3,5,9-pentaene-16,22-dione.
| Compound Name | (17S,23S)-14-ethenyl-7,7,14-trimethyl-8-oxa-12,15,21-triazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2(11),3,5,9-pentaene-16,22-dione |
|---|---|
| PubChem CID | 155544958 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | (17S,23S)-14-ethenyl-7,7,14-trimethyl-8-oxa-12,15,21-triazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2(11),3,5,9-pentaene-16,22-dione |
| SMILES | C=CC1(C)c2[nH]c3cc4c(cc3c2C[C@H]2C(=O)N3CCC[C@H]3C(=O)N21)C=CC(C)(C)O4 |
| InChI | InChI=1S/C25H27N3O3/c1-5-25(4)21-16(12-19-22(29)27-10-6-7-18(27)23(30)28(19)25)15-11-14-8-9-24(2,3)31-20(14)13-17(15)26-21/h5,8-9,11,13,18-19,26H,1,6-7,10,12H2,2-4H3/t18-,19-,25?/m0/s1 |
| InChIKey | IKCFVCSBYDMRCO-NHDFCTKWSA-N |
| XLogP | 3.51 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|