C21H28F3N7O2 — CID 155544961
5-[4,6-bis[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 155544961) has the molecular formula C21H28F3N7O2 and a molecular weight of 467.50 g/mol. Its IUPAC name is 5-[4,6-bis[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[4,6-bis[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 155544961 |
| Molecular Formula | C21H28F3N7O2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 5-[4,6-bis[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | C[C@H]1COC[C@H](C)N1c1nc(-c2cnc(N)cc2C(F)(F)F)nc(N2[C@@H](C)COC[C@@H]2C)n1 |
| InChI | InChI=1S/C21H28F3N7O2/c1-11-7-32-8-12(2)30(11)19-27-18(15-6-26-17(25)5-16(15)21(22,23)24)28-20(29-19)31-13(3)9-33-10-14(31)4/h5-6,11-14H,7-10H2,1-4H3,(H2,25,26)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | BGQSHVTXOIMPSQ-XUXIUFHCSA-N |
| XLogP | 2.76 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |