C24H23F3N4O2 — CID 155545048
N,N-dimethyl-3-[4-[6-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine (PubChem CID 155545048) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[6-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[6-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 155545048 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N,N-dimethyl-3-[4-[6-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2nnc3ccc(-c4cccc(OC(F)(F)F)c4)cn23)cc1 |
| InChI | InChI=1S/C24H23F3N4O2/c1-30(2)13-4-14-32-20-10-7-17(8-11-20)23-29-28-22-12-9-19(16-31(22)23)18-5-3-6-21(15-18)33-24(25,26)27/h3,5-12,15-16H,4,13-14H2,1-2H3 |
| InChIKey | KWYBPCOWJXBWKB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|