C13H15Cl3N8O4 — CID 155545198
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(4-aminopyrimidin-2-yl)amino]-2,2,2-trichloroethyl]carbamate (PubChem CID 155545198) has the molecular formula C13H15Cl3N8O4 and a molecular weight of 453.67 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(4-aminopyrimidin-2-yl)amino]-2,2,2-trichloroethyl]carbamate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(4-aminopyrimidin-2-yl)amino]-2,2,2-trichloroethyl]carbamate |
|---|---|
| PubChem CID | 155545198 |
| Molecular Formula | C13H15Cl3N8O4 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[1-[(4-aminopyrimidin-2-yl)amino]-2,2,2-trichloroethyl]carbamate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)NC(Nc1nccc(N)n1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl3N8O4/c1-7-19-6-9(24(26)27)23(7)4-5-28-12(25)22-10(13(14,15)16)21-11-18-3-2-8(17)20-11/h2-3,6,10H,4-5H2,1H3,(H,22,25)(H3,17,18,20,21) |
| InChIKey | LQXWRBFCWYVCBL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|