C21H23F6N3O2 — CID 155545255
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-ethynyl-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 155545255) has the molecular formula C21H23F6N3O2 and a molecular weight of 463.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-ethynyl-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-ethynyl-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155545255 |
| Molecular Formula | C21H23F6N3O2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-ethynyl-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | C#Cc1ccc(CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(N2CCCC2)c1 |
| InChI | InChI=1S/C21H23F6N3O2/c1-2-15-5-6-16(17(13-15)29-7-3-4-8-29)14-28-9-11-30(12-10-28)19(31)32-18(20(22,23)24)21(25,26)27/h1,5-6,13,18H,3-4,7-12,14H2 |
| InChIKey | IWMDEBPIZOQGLH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|