C19H14F6N2O2 — CID 155545261
5,5-dimethyl-1,3-bis[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 155545261) has the molecular formula C19H14F6N2O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-bis[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1,3-bis[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 155545261 |
| Molecular Formula | C19H14F6N2O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5,5-dimethyl-1,3-bis[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2cccc(C(F)(F)F)c2)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F6N2O2/c1-17(2)15(28)26(13-7-3-5-11(9-13)18(20,21)22)16(29)27(17)14-8-4-6-12(10-14)19(23,24)25/h3-10H,1-2H3 |
| InChIKey | BDAVKCQCSWFGLV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|