About 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one
6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 155545280) has the molecular formula C16H14BrClN4O
and a molecular weight of 393.67 g/mol. Its IUPAC name is 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| PubChem CID | 155545280 |
| Molecular Formula | C16H14BrClN4O |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C1Nc2cc(Br)ccc2C12CCN(c1ccc(Cl)nn1)CC2 |
| InChI | InChI=1S/C16H14BrClN4O/c17-10-1-2-11-12(9-10)19-15(23)16(11)5-7-22(8-6-16)14-4-3-13(18)20-21-14/h1-4,9H,5-8H2,(H,19,23) |
| InChIKey | JJBDJINPXOEABV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one?
The IUPAC name of 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one (CID 155545280) is 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one?
The canonical SMILES for 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one is O=C1Nc2cc(Br)ccc2C12CCN(c1ccc(Cl)nn1)CC2.
What is the InChIKey of 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one?
The InChIKey is JJBDJINPXOEABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrClN4O/c17-10-1-2-11-12(9-10)19-15(23)16(11)5-7-22(8-6-16)14-4-3-13(18)20-21-14/h1-4,9H,5-8H2,(H,19,23).
What are the key properties of 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one?
6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one has a molecular weight of 393.67 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 155545280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).