C27H32O2 — CID 155545328
[(1R,3aS,6aR)-5-hexyl-1-hydroxy-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]-phenylmethanone (PubChem CID 155545328) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(1R,3aS,6aR)-5-hexyl-1-hydroxy-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]-phenylmethanone.
| Compound Name | [(1R,3aS,6aR)-5-hexyl-1-hydroxy-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]-phenylmethanone |
|---|---|
| PubChem CID | 155545328 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [(1R,3aS,6aR)-5-hexyl-1-hydroxy-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-yl]-phenylmethanone |
| SMILES | CCCCCCC1=C(c2ccccc2)[C@]2(C(=O)c3ccccc3)CC[C@@H](O)[C@@H]2C1 |
| InChI | InChI=1S/C27H32O2/c1-2-3-4-7-16-22-19-23-24(28)17-18-27(23,25(22)20-12-8-5-9-13-20)26(29)21-14-10-6-11-15-21/h5-6,8-15,23-24,28H,2-4,7,16-19H2,1H3/t23-,24+,27-/m0/s1 |
| InChIKey | ODIJZAZIXNTRNZ-XFAFFCHDSA-N |
| XLogP | 6.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|