C18H21ClN4O — CID 155545523
5-(4-chlorophenyl)-2-heptyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 155545523) has the molecular formula C18H21ClN4O and a molecular weight of 344.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-heptyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(4-chlorophenyl)-2-heptyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155545523 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-(4-chlorophenyl)-2-heptyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCCCCc1nc2nc(-c3ccc(Cl)cc3)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C18H21ClN4O/c1-2-3-4-5-6-7-16-21-18-20-15(12-17(24)23(18)22-16)13-8-10-14(19)11-9-13/h8-12H,2-7H2,1H3,(H,20,21,22) |
| InChIKey | MGYODFSJJJZJGF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|