C10H18O7 — CID 155545789
1-[(3S,4R,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]propan-2-one (PubChem CID 155545789) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-[(3S,4R,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]propan-2-one.
| Compound Name | 1-[(3S,4R,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 155545789 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[(3S,4R,5S,6R)-6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O7/c1-4(12)2-6-7(14)8(15)9(16)10(17-6)5(13)3-11/h5-11,13-16H,2-3H2,1H3/t5-,6?,7+,8+,9-,10+/m0/s1 |
| InChIKey | SLMBKHJJMUAXPP-ZEHWMBNNSA-N |
| XLogP | -2.83 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |