C28H36N6O — CID 155545900
3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-hexylphenyl)propanamide (PubChem CID 155545900) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-hexylphenyl)propanamide.
| Compound Name | 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-hexylphenyl)propanamide |
|---|---|
| PubChem CID | 155545900 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 3-[4-[[(3aR,8bR)-2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-b]indol-8b-yl]methyl]triazol-1-yl]-N-(4-hexylphenyl)propanamide |
| SMILES | CCCCCCc1ccc(NC(=O)CCn2cc(C[C@@]34CNC[C@@H]3Nc3ccccc34)nn2)cc1 |
| InChI | InChI=1S/C28H36N6O/c1-2-3-4-5-8-21-11-13-22(14-12-21)30-27(35)15-16-34-19-23(32-33-34)17-28-20-29-18-26(28)31-25-10-7-6-9-24(25)28/h6-7,9-14,19,26,29,31H,2-5,8,15-18,20H2,1H3,(H,30,35)/t26-,28-/m0/s1 |
| InChIKey | NJJNNSOHAMRRHV-XCZPVHLTSA-N |
| XLogP | 4.31 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|