C21H20N2O — CID 155545908
(1E,3E,6E,8E)-1,9-bis(6-methyl-2-pyridinyl)nona-1,3,6,8-tetraen-5-one (PubChem CID 155545908) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is (1E,3E,6E,8E)-1,9-bis(6-methyl-2-pyridinyl)nona-1,3,6,8-tetraen-5-one.
| Compound Name | (1E,3E,6E,8E)-1,9-bis(6-methyl-2-pyridinyl)nona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 155545908 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (1E,3E,6E,8E)-1,9-bis(6-methyl-2-pyridinyl)nona-1,3,6,8-tetraen-5-one |
| SMILES | Cc1cccc(/C=C/C=C/C(=O)/C=C/C=C/c2cccc(C)n2)n1 |
| InChI | InChI=1S/C21H20N2O/c1-17-9-7-13-19(22-17)11-3-5-15-21(24)16-6-4-12-20-14-8-10-18(2)23-20/h3-16H,1-2H3/b11-3+,12-4+,15-5+,16-6+ |
| InChIKey | RKDCWNNGIGLDCS-WLURJCRGSA-N |
| XLogP | 4.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|