C20H16N4O3S3 — CID 155546102
2-prop-2-ynylsulfanyl-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 155546102) has the molecular formula C20H16N4O3S3 and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-prop-2-ynylsulfanyl-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2-prop-2-ynylsulfanyl-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155546102 |
| Molecular Formula | C20H16N4O3S3 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-prop-2-ynylsulfanyl-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | C#CCSc1nc(Sc2nccs2)c(C#N)c(-c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C20H16N4O3S3/c1-5-7-28-19-23-16(12-9-14(25-2)17(27-4)15(10-12)26-3)13(11-21)18(24-19)30-20-22-6-8-29-20/h1,6,8-10H,7H2,2-4H3 |
| InChIKey | UMFGYTRZVQGWNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|