About 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide
3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide (PubChem CID 155546187) has the molecular formula C10H11Cl2NO3
and a molecular weight of 264.11 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide |
| PubChem CID | 155546187 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide |
| SMILES | CN(O)C(=O)CC(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c1-13(16)10(15)5-9(14)6-2-3-7(11)8(12)4-6/h2-4,9,14,16H,5H2,1H3 |
| InChIKey | IVEMKCFSUXSZIE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide?
The IUPAC name of 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide (CID 155546187) is 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide?
The canonical SMILES for 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide is CN(O)C(=O)CC(O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide?
The InChIKey is IVEMKCFSUXSZIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3/c1-13(16)10(15)5-9(14)6-2-3-7(11)8(12)4-6/h2-4,9,14,16H,5H2,1H3.
What are the key properties of 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide?
3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide has a molecular weight of 264.11 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-N,3-dihydroxy-N-methylpropanamide is sourced from PubChem (CID 155546187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).