C29H32FN7S — CID 155546230
4-[4-(4-fluorophenyl)-2-piperidin-4-yl-1,3-thiazol-5-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 155546230) has the molecular formula C29H32FN7S and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-2-piperidin-4-yl-1,3-thiazol-5-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[4-(4-fluorophenyl)-2-piperidin-4-yl-1,3-thiazol-5-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155546230 |
| Molecular Formula | C29H32FN7S |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-2-piperidin-4-yl-1,3-thiazol-5-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4sc(C5CCNCC5)nc4-c4ccc(F)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H32FN7S/c1-36-16-18-37(19-17-36)24-8-6-23(7-9-24)33-29-32-15-12-25(34-29)27-26(20-2-4-22(30)5-3-20)35-28(38-27)21-10-13-31-14-11-21/h2-9,12,15,21,31H,10-11,13-14,16-19H2,1H3,(H,32,33,34) |
| InChIKey | VGHIIWVNJHJIHO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|