C26H36O — CID 155546285
(2S,3aS,5aR,6R,9aR,9bS)-6-benzyl-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran (PubChem CID 155546285) has the molecular formula C26H36O and a molecular weight of 364.57 g/mol. Its IUPAC name is (2S,3aS,5aR,6R,9aR,9bS)-6-benzyl-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran.
| Compound Name | (2S,3aS,5aR,6R,9aR,9bS)-6-benzyl-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 155546285 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (2S,3aS,5aR,6R,9aR,9bS)-6-benzyl-5a,9b-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3a,4,5,6,8,9,9a-octahydro-1H-benzo[e][1]benzofuran |
| SMILES | C=C1CC[C@H]2[C@]3(C)C[C@@H](C=C(C)C)O[C@H]3CC[C@]2(C)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H36O/c1-18(2)15-21-17-26(5)23-12-11-19(3)22(16-20-9-7-6-8-10-20)25(23,4)14-13-24(26)27-21/h6-10,15,21-24H,3,11-14,16-17H2,1-2,4-5H3/t21-,22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | LFRCXHVZBMHBGX-VMKZMFFZSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|