C31H34F2N4O2 — CID 155546303
2-[4-[3-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 155546303) has the molecular formula C31H34F2N4O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 2-[4-[3-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione.
| Compound Name | 2-[4-[3-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
|---|---|
| PubChem CID | 155546303 |
| Molecular Formula | C31H34F2N4O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[4-[3-(5-fluoro-1H-indol-3-yl)piperidin-1-yl]butyl]-4-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | O=c1c(-c2ccccc2F)c2n(c(=O)n1CCCCN1CCCC(c3c[nH]c4ccc(F)cc34)C1)CCCC2 |
| InChI | InChI=1S/C31H34F2N4O2/c32-22-12-13-27-24(18-22)25(19-34-27)21-8-7-15-35(20-21)14-5-6-17-37-30(38)29(23-9-1-2-10-26(23)33)28-11-3-4-16-36(28)31(37)39/h1-2,9-10,12-13,18-19,21,34H,3-8,11,14-17,20H2 |
| InChIKey | RTNOGXUTXBJBLW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|