About 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole
2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole (PubChem CID 155546498) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole |
| PubChem CID | 155546498 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole |
| SMILES | C(/C=C/c1nc2ccccc2o1)=C\c1ccccn1 |
| InChI | InChI=1S/C16H12N2O/c1(7-13-8-5-6-12-17-13)4-11-16-18-14-9-2-3-10-15(14)19-16/h1-12H/b7-1+,11-4+ |
| InChIKey | RLZRJZVTLPNXFU-IJJWMGEWSA-N |
| XLogP | 3.95 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole?
The IUPAC name of 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole (CID 155546498) is 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole?
The canonical SMILES for 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole is C(/C=C/c1nc2ccccc2o1)=C\c1ccccn1.
What is the InChIKey of 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole?
The InChIKey is RLZRJZVTLPNXFU-IJJWMGEWSA-N. The full InChI is InChI=1S/C16H12N2O/c1(7-13-8-5-6-12-17-13)4-11-16-18-14-9-2-3-10-15(14)19-16/h1-12H/b7-1+,11-4+.
What are the key properties of 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole?
2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole has a molecular weight of 248.29 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E,3E)-4-pyridin-2-ylbuta-1,3-dienyl]-1,3-benzoxazole is sourced from PubChem (CID 155546498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).