C42H48N2O3 — CID 155546680
5-[(2R,3R,4R,5S)-1-(naphthalen-1-ylmethyl)-3,4,5-tris(phenylmethoxy)piperidin-2-yl]pentan-1-amine (PubChem CID 155546680) has the molecular formula C42H48N2O3 and a molecular weight of 628.86 g/mol. Its IUPAC name is 5-[(2R,3R,4R,5S)-1-(naphthalen-1-ylmethyl)-3,4,5-tris(phenylmethoxy)piperidin-2-yl]pentan-1-amine.
| Compound Name | 5-[(2R,3R,4R,5S)-1-(naphthalen-1-ylmethyl)-3,4,5-tris(phenylmethoxy)piperidin-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 155546680 |
| Molecular Formula | C42H48N2O3 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 5-[(2R,3R,4R,5S)-1-(naphthalen-1-ylmethyl)-3,4,5-tris(phenylmethoxy)piperidin-2-yl]pentan-1-amine |
| SMILES | NCCCCC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C42H48N2O3/c43-27-14-4-11-26-39-41(46-31-34-18-7-2-8-19-34)42(47-32-35-20-9-3-10-21-35)40(45-30-33-16-5-1-6-17-33)29-44(39)28-37-24-15-23-36-22-12-13-25-38(36)37/h1-3,5-10,12-13,15-25,39-42H,4,11,14,26-32,43H2/t39-,40+,41-,42-/m1/s1 |
| InChIKey | CGDCKGLQKVGUCQ-SZRGUQLDSA-N |
| XLogP | 8.30 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|