C26H29N5O2S2 — CID 155546990
3-(2-methoxyethylamino)-N-[3-[5-(2-methyl-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155546990) has the molecular formula C26H29N5O2S2 and a molecular weight of 507.69 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-(2-methyl-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-(2-methyl-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155546990 |
| Molecular Formula | C26H29N5O2S2 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-(2-methyl-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccnc(C)c4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C26H29N5O2S2/c1-16-13-18(5-10-29-16)17-3-4-21-20(14-17)30-25(34-21)24-19-6-8-28-15-22(19)35-26(24)31-23(32)7-9-27-11-12-33-2/h3-5,10,13-14,27-28H,6-9,11-12,15H2,1-2H3,(H,31,32) |
| InChIKey | MKTOVQYLSQSJCC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|