C15H14N8O2 — CID 155547048
4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-N-[(E)-furan-2-ylmethylideneamino]benzamide (PubChem CID 155547048) has the molecular formula C15H14N8O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-N-[(E)-furan-2-ylmethylideneamino]benzamide.
| Compound Name | 4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-N-[(E)-furan-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 155547048 |
| Molecular Formula | C15H14N8O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]-N-[(E)-furan-2-ylmethylideneamino]benzamide |
| SMILES | Nc1nc(N)nc(Nc2ccc(C(=O)N/N=C/c3ccco3)cc2)n1 |
| InChI | InChI=1S/C15H14N8O2/c16-13-20-14(17)22-15(21-13)19-10-5-3-9(4-6-10)12(24)23-18-8-11-2-1-7-25-11/h1-8H,(H,23,24)(H5,16,17,19,20,21,22)/b18-8+ |
| InChIKey | MSWNGKMJRFFYJY-QGMBQPNBSA-N |
| XLogP | 1.14 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|