C17H17N5 — CID 155547051
2-N-benzyl-6-(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155547051) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N-benzyl-6-(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155547051 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-N-benzyl-6-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1-c1nc(N)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H17N5/c1-12-7-5-6-10-14(12)15-20-16(18)22-17(21-15)19-11-13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | GTIWQOJBKWQSCX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |