C32H40N4O2 — CID 155547149
N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-8-(1,2,3,4-tetrahydroacridin-9-ylamino)octanamide (PubChem CID 155547149) has the molecular formula C32H40N4O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-8-(1,2,3,4-tetrahydroacridin-9-ylamino)octanamide.
| Compound Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-8-(1,2,3,4-tetrahydroacridin-9-ylamino)octanamide |
|---|---|
| PubChem CID | 155547149 |
| Molecular Formula | C32H40N4O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-8-(1,2,3,4-tetrahydroacridin-9-ylamino)octanamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CCCCCCCNc3c4c(nc5ccccc35)CCCC4)c2c1 |
| InChI | InChI=1S/C32H40N4O2/c1-38-24-16-17-28-27(21-24)23(22-35-28)18-20-33-31(37)15-5-3-2-4-10-19-34-32-25-11-6-8-13-29(25)36-30-14-9-7-12-26(30)32/h6,8,11,13,16-17,21-22,35H,2-5,7,9-10,12,14-15,18-20H2,1H3,(H,33,37)(H,34,36) |
| InChIKey | XLVBRAZAMLPBJD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|