About 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one
2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one (PubChem CID 155547224) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 155547224 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1cccc2c1C(=O)CC(CCCNCCCO)O2 |
| InChI | InChI=1S/C16H23NO3/c1-12-5-2-7-15-16(12)14(19)11-13(20-15)6-3-8-17-9-4-10-18/h2,5,7,13,17-18H,3-4,6,8-11H2,1H3 |
| InChIKey | RXFIBMYFRQOFLM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one (CID 155547224) is 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one is Cc1cccc2c1C(=O)CC(CCCNCCCO)O2.
What is the InChIKey of 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one?
The InChIKey is RXFIBMYFRQOFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-12-5-2-7-15-16(12)14(19)11-13(20-15)6-3-8-17-9-4-10-18/h2,5,7,13,17-18H,3-4,6,8-11H2,1H3.
What are the key properties of 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one?
2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one has a molecular weight of 277.36 g/mol, XLogP of 2.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-hydroxypropylamino)propyl]-5-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 155547224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).